CAS 18456-02-5

Fórmula: C15H20O4

InChI: InChI=1S/C15H20O4/c1-8-4-5-10(16)11-12(17)15(7-14(8,11)3)9(2)6-19-13(15)18/h8,11-12,17H,2,4-7H2,1,3H3

Clave InChI: QXPYCDJQTAYYAJ-UHFFFAOYSA-N

SMILES: CC1CCC(=O)C2C1(CC3(C2O)C(=C)COC3=O)C

1-Oxobakkenolide S

CAS: 18456-02-5

1-Oxobakkenolide S is a natural product for research related to life sciences. The catalog number is TN2562 and the CAS number is 18456-02-5.

Fórmula: C₁₅H₂₀O₄

Pureza: 98%

Forma y color: Solid

Peso molecular: 264.32

Ref: TM-TN2562

1-Oxobakkenolide S

CAS: 18456-02-5

Fórmula: C₁₅H₂₀O₄

Pureza: 95%~99%

Peso molecular: 264.321

Ref: BP-SBP03774

1-Oxobakkenolide S

CAS: 18456-02-5

1-Oxobakkenolide S is a sesquiterpene lactone, which is a type of natural compound. It is sourced from various plants, particularly from the Asteraceae family, known for their diverse array of sesquiterpene lactones. These compounds are typically found in the essential oils of plants and contribute to their bioactivity.

Fórmula: C₁₅H₂₀O₄

Pureza: Min. 95%

Peso molecular: 264.32 g/mol

Ref: 3D-TAA45602