CAS 185020-38-6

Fórmula: C17H16O2

InChI: InChI=1S/C17H16O2/c1-2-14(15-7-11-17(19)12-8-15)6-3-13-4-9-16(18)10-5-13/h2-12,14,18-19H,1H2/b6-3-/t14-/m0/s1

Clave InChI: VEAUNWQYYMXIRB-XSHSDMCLSA-N

SMILES: C=C[C@@H](/C=C\C1=CC=C(C=C1)O)C2=CC=C(C=C2)O

Phenol, 4,4'-[(1Z,3S)-3-ethenyl-1-propene-1,3-diyl]bis-

CAS: 185020-38-6

Phenol, 4,4'-[(1Z,3S)-3-ethenyl-1-propene-1,3-diyl]bis-

Fórmula: C₁₇H₁₆O₂

Pureza: ≥98%

Peso molecular: 252.31

Ref: 54-OR1132445

Phenol, 4,4'-[(1Z,3S)-3-ethenyl-1-propene-1,3-diyl]bis-

CAS: 185020-38-6

Fórmula: C₁₇H₁₆O₂

Pureza: 98%

Peso molecular: 252.3077

Ref: IN-DA01HFXL

(+)-Nyasol

CAS: 185020-38-6

(+)-Nyasol is a naturally occurring lignan, which is a type of phenylpropanoid compound. It is derived from the roots of the medicinal plant Anemarrhena asphodeloides, commonly used in traditional Chinese medicine. The mode of action of (+)-Nyasol primarily involves its anti-inflammatory and antioxidant properties, which are attributed to its ability to inhibit key pro-inflammatory pathways and reactive oxygen species. It modulates signaling pathways, such as the NF-κB pathway, crucial for the expression of inflammatory cytokines.

Fórmula: C₁₇H₁₆O₂

Pureza: Min. 95%

Peso molecular: 252.31 g/mol

Ref: 3D-KHA02038