CAS 204509-08-0

Fórmula: C5H10O3

InChI: InChI=1S/C5H10O3/c6-2-5-1-4(7)3-8-5/h4-7H,1-3H2/t4-,5-/m0/s1

Clave InChI: WDMXOLOBWMBITN-WHFBIAKZSA-N

SMILES: C1[C@@H](CO[C@@H]1CO)O

(3S,5S)-5-(Hydroxymethyl)tetrahydrofuran-3-ol

CAS: 204509-08-0

(3S,5S)-5-(Hydroxymethyl)tetrahydrofuran-3-ol

Fórmula: C₅H₁₀O₃

Pureza: 95%

Peso molecular: 118.13

Ref: 54-OR1105460

(3S,5S)-5-(Hydroxymethyl)Tetrahydrofuran-3-Ol

CAS: 204509-08-0

Fórmula: C₅H₁₀O₃

Pureza: 95%

Forma y color: Liquid

Peso molecular: 118.1311

Ref: IN-DA00CFL4

1, 4- Anhydro- 3- deoxy-D- threo- pentitol

CAS: 204509-08-0

1,4-Anhydro-3-deoxy-D-threo-pentitol is a custom synthesis of a monosaccharide. The structure consists of a hydrogen attached to the oxygen on the anomeric carbon which is then substituted with fluorine. The hydroxyl group on C1 is methylated and then reduced to form a hemiacetal linkage with the C6 hydroxyl group. This product can be used in glycosylation reactions to produce complex carbohydrates.

Fórmula: C₅H₁₀O₃

Pureza: Min. 95%

Peso molecular: 118.13 g/mol

Ref: 3D-MA153478