CAS 20913-18-2

Fórmula: C11H14N2O4

InChI: InChI=1S/C11H14N2O4/c1-7-8(12-10(14)16-2)5-4-6-9(7)13-11(15)17-3/h4-6H,1-3H3,(H,12,14)(H,13,15)

Clave InChI: JNNLWOJZIPJIQG-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1NC(=O)OC)NC(=O)OC

Dimethyl (2-methyl-1,3-phenylene)dicarbamate

CAS: 20913-18-2

Dimethyl (2-methyl-1,3-phenylene)dicarbamate

Fórmula: C₁₁H₁₄N₂O₄

Pureza: 98%

Peso molecular: 238.24

Ref: 54-OR1063663

Carbamic acid, N,N'-(2-methyl-1,3-phenylene)bis-, C,C'-dimethyl ester

CAS: 20913-18-2

Fórmula: C₁₁H₁₄N₂O₄

Pureza: 98%

Forma y color: Solid

Peso molecular: 238.2399

Ref: IN-DA002K2A

Obtucarbamate B

CAS: 20913-18-2

Fórmula: C₁₁H₁₄N₂O₄

Pureza: 95%~99%

Peso molecular: 238.243

Ref: BP-SBP02742

Obtucarbamate B

CAS: 20913-18-2

Obtucarbamate B is a naturally occurring bioactive compound, belonging to the class of carbamate derivatives. It is isolated from certain plant sources renowned for their secondary metabolites with therapeutic potential. The mode of action of Obtucarbamate B involves the selective inhibition of specific enzymatic functions, which can interfere with various biochemical pathways fundamental to cellular processes.

Fórmula: C₁₁H₁₄N₂O₄

Pureza: Min. 95%

Peso molecular: 238.24 g/mol

Ref: 3D-VAA91318