CAS 2183440-42-6

Fórmula: C27H27ClN2O6

InChI: InChI=1S/C27H26N2O6.ClH/c28-11-3-1-2-4-12-29-25(32)16-5-8-19-22(13-16)27(35-26(19)33)20-9-6-17(30)14-23(20)34-24-15-18(31)7-10-21(24)27;/h5-10,13-15,30-31H,1-4,11-12,28H2,(H,29,32);1H

Clave InChI: BHBCBUGWIUDCSL-UHFFFAOYSA-N

SMILES: C1=CC2=C(C=C1C(=O)NCCCCCCN)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O.Cl

FAM amine, 6-isomer

CAS: 2183440-42-6

FAM amine, 6-isomer

Fórmula: C₂₇H₂₇ClN₂O₆

Pureza: 95%

Peso molecular: 510.98

Ref: 54-BIPG2281

FAM amine, 6-isomer

CAS: 2183440-42-6

Pureza: 95%

Ref: IN-DA019EI4

FAM amine, 6-isomer

CAS: 2183440-42-6

FAM amine, 6-isomer, is a fluorescein derivative with an amine group and an isomer of the fluorophore. It can modify biomolecules through enzymatic transamination and its fatty amine groups can react with electrophiles such as activated esters. Additionally, the amine can be conjugated to carbonyl compounds (aldehydes and ketones) by reductive amination.

Fórmula: C₂₇H₂₇ClN₂O₆

Peso molecular: 510.97

Ref: TM-T86403