CAS 219916-77-5

Fórmula: C35H46O12

InChI: InChI=1S/C35H46O12/c1-18-14-34(42)26(27(18)46-29(40)23-12-10-9-11-13-23)28(44-20(3)37)32(7)17-35(47-22(5)39)24(33(32,8)30(34)45-21(4)38)15-31(6,41)16-25(35)43-19(2)36/h9-13,18,24-28,30,41-42H,14-17H2,1-8H3/t18-,24-,25-,26+,27-,28+,30+,31+,32-,33+,34+,35-/m0/s1

Clave InChI: YOOFGOIZRALNAL-ZMHDZMPESA-N

SMILES: C[C@H]1C[C@]2([C@H]([C@H]1OC(=O)C3=CC=CC=C3)[C@H]([C@@]4(C[C@@]5([C@H]([C@@]4([C@H]2OC(=O)C)C)C[C@@](C[C@@H]5OC(=O)C)(C)O)OC(=O)C)C)OC(=O)C)O

5-hydroxythalidomide

CAS: 219916-77-5

5-hydroxythalidomide is a natural product for research related to life sciences. The catalog number is TN3098 and the CAS number is 219916-77-5.

Fórmula: C₃₅H₄₆O₁₂

Pureza: 98%

Forma y color: Solid

Peso molecular: 658.741

Ref: TM-TN3098

5,8,9,14-Tetraacetoxy-3-benzoyloxy-10,15-dihydroxypepluane

CAS: 219916-77-5

Fórmula: C₃₅H₄₆O₁₂

Pureza: 95%~99%

Peso molecular: 658.741

Ref: BP-SBP03651

5,8,9,14-Tetraacetoxy-3-benzoyloxy-10,15-dihydroxypepluane

CAS: 219916-77-5

5,8,9,14-Tetraacetoxy-3-benzoyloxy-10,15-dihydroxypepluane is a complex triterpenoid compound, which is commonly isolated from the aerial parts of the plant species typically found in the Phyllanthus genus. These plants are widely recognized in traditional medicine systems for their therapeutic properties. The compound's mode of action involves modulating various biological pathways, potentially influencing cellular processes such as apoptosis and inflammation. It may interact with key enzymes or receptors within these pathways, although the precise molecular mechanisms remain an active area of research.

Fórmula: C₃₅H₄₆O₁₂

Pureza: Min. 95%

Peso molecular: 658.7 g/mol

Ref: 3D-UIA91677