CAS 220611-41-6

Fórmula: C30H22O10

InChI: InChI=1S/C30H22O10/c31-15-5-1-13(2-6-15)22-12-21(37)24-19(35)11-20(36)26(30(24)39-22)27-28(38)25-18(34)9-17(33)10-23(25)40-29(27)14-3-7-16(32)8-4-14/h1-11,22,27,29,31-36H,12H2/t22-,27+,29-/m1/s1

Clave InChI: MXEIKUWMKSYEII-KBKXWFDOSA-N

SMILES: C1[C@@H](OC2=C(C(=CC(=C2C1=O)O)O)[C@@H]3[C@H](OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)C6=CC=C(C=C6)O

GB 1a

CAS: 220611-41-6

GB 1a is a natural product isolated from the leaves of Garcinia travancorica.

Fórmula: C₃₀H₂₂O₁₀

Pureza: 98%

Forma y color: Solid

Peso molecular: 542.49

Ref: TM-TN4117

GB-1a

CAS: 220611-41-6

Fórmula: C₃₀H₂₂O₁₀

Pureza: 95%~99%

Peso molecular: 542.496

Ref: BP-SBP04251

GB-1a

CAS: 220611-41-6

GB-1a is a recombinant protein, which is derived from molecular genetic engineering techniques, designed to interact with specific cellular pathways involved in oncological processes. Its source involves the manipulation and expression of targeted genes within host cells, typically using bacterial or mammalian expression systems to ensure high fidelity and functionality. The mode of action for GB-1a is its ability to bind to target molecules within the cancer signaling pathways, thereby modulating their activity to inhibit uncontrolled cell proliferation.

Fórmula: C₃₀H₂₂O₁₀

Pureza: Min. 95%

Peso molecular: 542.5 g/mol

Ref: 3D-VIA61141