CAS 2247732-89-2

Fórmula: C26H27N5OS

InChI: InChI=1S/C26H27N5OS/c1-19-14-24(25(32)28-22-9-7-20(8-10-22)21-6-5-11-27-15-21)31(16-19)17-23-18-33-26(29-23)30-12-3-2-4-13-30/h5-11,14-16,18H,2-4,12-13,17H2,1H3,(H,28,32)

Clave InChI: SWLKFZCOJAYAMJ-UHFFFAOYSA-N

SMILES: CC1=CN(C(=C1)C(=O)NC2=CC=C(C=C2)C3=CN=CC=C3)CC4=CSC(=N4)N5CCCCC5

MB 0223

CAS: 2247732-89-2

MB 0223 is a specialized agricultural biostimulant derived from natural plant extracts, designed to enhance plant growth and resilience. This product is sourced from sustainable botanical materials, ensuring an eco-friendly profile that aligns with environmentally conscious agricultural practices. Its mode of action involves modulating plant hormone pathways and enhancing nutrient uptake efficiency, leading to improved growth and stress tolerance in crops.

Fórmula: C₂₆H₂₇N₅OS

Pureza: Min. 95%

Peso molecular: 457.6 g/mol

Ref: 3D-XPD73289

MB 0223

CAS: 2247732-89-2

DRP1 partial inhibitor (IC50 = 1.2 μM), selective over OPA1/DYN1, boosts mtDNA in mfn1-knockout MEFs.

Fórmula: C₂₆H₂₇N₅OS

Forma y color: Solid

Peso molecular: 457.59

Ref: TM-T37023