CAS 2411999-52-3

Fórmula: C24H24O7

InChI: InChI=1S/C24H24O7/c1-29-19-5-4-14(20(26)10-19)6-16-7-15(21(27)11-23(16)30-2)8-17-9-18(13-25)22(28)12-24(17)31-3/h4-5,7,9-13,26-28H,6,8H2,1-3H3

Clave InChI: ISIUBTXAUJTCIZ-UHFFFAOYSA-N

SMILES: COC1=CC(=C(C=C1)CC2=CC(=C(C=C2OC)O)CC3=CC(=C(C=C3OC)O)C=O)O

Sepiumol A

CAS: 2411999-52-3

Sepiumol A is a polyphenolic compound isolated from the root bark of Periploca sepium with significant antifungal activity.

Fórmula: C₂₄H₂₄O₇

Pureza: 98%

Forma y color: Solid

Peso molecular: 424.44

Ref: TM-TN6295

Sepiumol A

CAS: 2411999-52-3

Sepiumol A is a biosurfactant, which is derived from plant-based sources, specifically the leaves of the species *Sebaceous sepium*. This compound functions by reducing surface tension between substances, thereby facilitating the mixing of water and oil phases or enhancing surface wetting properties. Sepiumol A achieves this via its amphiphilic molecular structure, featuring hydrophilic and hydrophobic regions that orient themselves at interfaces between different phases.

Fórmula: C₂₄H₂₄O₇

Pureza: Min. 95%

Peso molecular: 424.4 g/mol

Ref: 3D-LWD99952