CAS 27928-00-3

1,3,6-Pyrenetrisulfonicacid, 8-hydroxy-

Fórmula: C₁₆H₁₀O₁₀S₃

InChI: InChI=1S/C16H10O10S3/c17-11-5-12(27(18,19)20)8-3-4-10-14(29(24,25)26)6-13(28(21,22)23)9-2-1-7(11)15(8)16(9)10/h1-6,17H,(H,18,19,20)(H,21,22,23)(H,24,25,26)

Clave InChI: OBJOZRVSMLPASY-UHFFFAOYSA-N

SMILES: C1=CC2=C3C(=C(C=C2S(=O)(=O)O)S(=O)(=O)O)C=CC4=C(C=C(C1=C43)O)S(=O)(=O)O

Sinónimos:

• 1-Hydroxypyrene-3,6,8-trisulfonicacid
• 8-Hydroxypyrene-1,3,6-trisulfonic acid

8-Hydroxypyrene-1,3,6-trisulfonic acid

CAS: 27928-00-3

8-Hydroxypyrene-1,3,6-trisulfonic acid serves as a versatile dye with applications spanning various fields. Commonly utilized in biological experiments, these dyes enable researchers to examine cell structures, track biomolecules, assess cell functions, differentiate between cell types, detect biomolecules, explore tissue pathology, and monitor microorganisms. Their utility extends beyond basic scientific research, encompassing a broad spectrum of clinical diagnostics. Additionally, dyes play a crucial role in traditional industries like textile dyeing and are increasingly important in emerging areas, including functional textile processing, food pigments, and dye-sensitized solar cells.

Fórmula: C₁₆H₁₀O₁₀S₃

Forma y color: Solid

Peso molecular: 458.44

Ref: TM-T85527