CAS 283159-94-4

Fórmula: C19H27ClN2O5

InChI: InChI=1S/C19H27ClN2O5/c1-11(2)17(22-19(25)27-12(3)4)18(24)21-15(10-16(23)26-5)13-6-8-14(20)9-7-13/h6-9,11-12,15,17H,10H2,1-5H3,(H,21,24)(H,22,25)/t15-,17-/m0/s1

Clave InChI: DBXFMOWZRXXBRN-RDJZCZTQSA-N

SMILES: CC(C)[C@@H](C(=O)N[C@@H](CC(=O)OC)C1=CC=C(C=C1)Cl)NC(=O)OC(C)C

(S,S)-Valifenalate

CAS: 283159-94-4

(S,S)-Valifenalate

Fórmula: C₁₉H₂₇ClN₂O₅

Pureza: 98.0%

Peso molecular: 398.88

Ref: 54-OR1138236

(S,S)-Valifenalate

CAS: 283159-94-4

(S,S)-Valifenalate is an acylamino acid fungicide and is used to control a wide range of fungi belonging to the class of Oomycetes.

Fórmula: C₁₉H₂₇ClN₂O₅

Forma y color: Solid

Peso molecular: 398.881

Ref: TM-T13878

(S,S)-Valifenalate

CAS: 283159-94-4

Fórmula: C₁₉H₂₇ClN₂O₅

Pureza: 98.0%

Peso molecular: 398.8811

Ref: IN-DA01V69V

(S,S)-Valifenalate

CAS: 283159-94-4

(S,S)-Valifenalate is a chemical compound that serves as a systemic fungicide, a class of products designed to prevent or eliminate fungal diseases in plants. It is synthetically derived, indicating that its molecular structure is chemically engineered rather than extracted from natural sources. The compound operates by disrupting the fungal life cycle, specifically interfering with cell wall biosynthesis, ultimately inhibiting the growth and reproduction of fungal pathogens.

Fórmula: C₁₉H₂₇ClN₂O₅

Pureza: Min. 95%

Peso molecular: 398.9 g/mol

Ref: 3D-ILA15994