CAS 2951078-67-2

Fórmula: C15H16N4O8

InChI: InChI=1S/C15H16N4O8/c20-14(10-4-6-12(26-10)18(22)23)16-8-2-1-3-9-17-15(21)11-5-7-13(27-11)19(24)25/h4-7H,1-3,8-9H2,(H,16,20)(H,17,21)

Clave InChI: FWFARJQDNUCDBL-UHFFFAOYSA-N

SMILES: C1=C(OC(=C1)[N+](=O)[O-])C(=O)NCCCCCNC(=O)C2=CC=C(O2)[N+](=O)[O-]

STING agonist-30

CAS: 2951078-67-2

STING agonist-30

Fórmula: C₁₅H₁₆N₄O₈

Pureza: ≥98%

Peso molecular: 380.31

Ref: 54-BUP07357

STING Agonist 23

CAS: 2951078-67-2

Fórmula: C₁₅H₁₆N₄O₈

Peso molecular: 380.3095

Ref: IN-DA027SPL

STING agonist-30

CAS: 2951078-67-2

STING agonist-30 is a STING agonist that stimulates STING-dependent immune activation and inhibits HSV, rotavirus and SARS-CoV-2.

Fórmula: C₁₅H₁₆N₄O₈

Pureza: 99.88%

Forma y color: White Solid

Peso molecular: 380.31

Ref: TM-T74809