CAS 31002-27-4

Fórmula: C15H20O9

InChI: InChI=1S/C15H20O9/c1-21-8-4-3-7(5-9(8)22-2)14(20)24-15-13(19)12(18)11(17)10(6-16)23-15/h3-5,10-13,15-19H,6H2,1-2H3/t10-,11-,12+,13-,15+/m1/s1

Clave InChI: SSWOBGVMZQWPTN-VVSAWPALSA-N

SMILES: COC1=C(C=C(C=C1)C(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC

Tecomin

CAS: 31002-27-4

Tecomin is an insecticidal product, which is derived from botanical sources with a neurotoxic mode of action. This product is developed by extracting active compounds from plants known for their pesticidal properties. The primary mode of action involves the disruption of the nervous systems of target insect species by interfering with neurotransmitter functions, ultimately leading to paralysis and death of the pests.

Fórmula: C₁₅H₂₀O₉

Pureza: Min. 95%

Peso molecular: 344.31 g/mol

Ref: 3D-GBA00227