CAS 320624-68-8

Fórmula: C22H28O5

InChI: InChI=1S/C22H28O5/c1-15(6-10-19-21(2,3)27-22(4,5)26-19)12-13-24-17-9-7-16-8-11-20(23)25-18(16)14-17/h7-9,11-12,14,19H,6,10,13H2,1-5H3/b15-12+/t19-/m1/s1

Clave InChI: AECCGECAEDOGOS-LBKOFNPBSA-N

SMILES: C/C(=C\COC1=CC2=C(C=C1)C=CC(=O)O2)/CC[C@@H]3C(OC(O3)(C)C)(C)C

Marmin acetonide

CAS: 320624-68-8

Fórmula: C₂₂H₂₈O₅

Pureza: 98.5%

Peso molecular: 372.4547

Ref: IN-DA00CHV2

Marmin acetonide

CAS: 320624-68-8

Marmin acetonide is a natural product of Citrus, Rutaceae.

Fórmula: C₂₂H₂₈O₅

Pureza: 98%

Forma y color: Solid

Peso molecular: 372.45

Ref: TM-TN4499

Marmin acetonide

CAS: 320624-68-8

Fórmula: C₂₂H₂₈O₅

Pureza: 95%~99%

Forma y color: Powder

Peso molecular: 372.461

Ref: BP-SBP02224

Marmin acetonide

CAS: 320624-68-8

Marmin acetonide is a synthetic corticosteroid, which is derived from the chemical modification of naturally occurring steroid hormones in the adrenal cortex. It encompasses a potent anti-inflammatory mode of action by inhibiting the synthesis of pro-inflammatory mediators such as prostaglandins and leukotrienes. Additionally, it modulates immune responses by interfering with cytokine production and lymphocyte proliferation.

Fórmula: C₂₂H₂₈O₅

Pureza: Min. 95%

Peso molecular: 372.5 g/mol

Ref: 3D-VMA62468