CAS 321125-94-4

Fórmula: C23H21F7N4O3

InChI: InChI=1S/C23H21F7N4O3/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)37-20-19(13-2-4-17(24)5-3-13)34(6-7-36-20)11-18-31-21(35)33-32-18/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H2,31,32,33,35)/t12-,19+,20-/m1/s1

Clave InChI: ATALOFNDEOCMKK-OITMNORJSA-N

SMILES: C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](N(CCO2)CC3=NNC(=O)N3)C4=CC=C(C=C4)F

Aprepitant-d4 (Mixture of Enantiomers)

CAS: 321125-94-4

Fórmula: C₂₃H₁₇D₄F₇N₄O₃

Forma y color: White To Off-White Solid

Peso molecular: 538.46

Ref: 4Z-A-322

Aprepitant β-glucuronide sodium salt

CAS: 321125-94-4

Aprepitant β-glucuronide sodium salt is a unique compound that has been shown to have potent anti-cancer properties. It works by inhibiting the cell cycle and inducing apoptosis in cancer cells. Aprepitant β-glucuronide sodium salt has been extensively studied in Chinese medicine and has shown promising results as an anticancer agent. This compound can be used to target specific proteins involved in the growth and proliferation of cancer cells, making it a highly effective treatment option for various types of tumors. Additionally, nanoparticles containing Aprepitant β-glucuronide sodium salt have been developed, which allows for targeted delivery and improved efficacy. Overall, this innovative compound holds great potential as a powerful tool in the fight against cancer.

Fórmula: C₂₃H₂₁F₇N₄O₃

Pureza: Min. 95%

Peso molecular: 534.4 g/mol

Ref: 3D-WMA12594