CAS 321839-75-2

Fórmula: C27H29Cl2FN2OS

InChI: InChI=1S/C27H28ClFN2OS.ClH/c1-6-11-31(24(13-19-8-9-19)20-10-7-16(2)23(29)14-20)27-30-26(18(4)33-27)21-12-17(3)25(32-5)15-22(21)28;/h1,7,10,12,14-15,19,24H,8-9,11,13H2,2-5H3;1H/t24-;/m0./s1

Clave InChI: BMXALUHUEGRRCH-JIDHJSLPSA-N

SMILES: CC1=C(C=C(C=C1)[C@H](CC2CC2)N(CC#C)C3=NC(=C(S3)C)C4=C(C=C(C(=C4)C)OC)Cl)F.Cl

Crinecerfont (hydrochloride)

CAS: 321839-75-2

Crinecerfont (hydrochloride)

Fórmula: C₂₇H₂₉Cl₂FN₂OS

Pureza: 98%

Peso molecular: 519.5

Ref: 54-PC1033188

Crinecerfont hydrochloride

CAS: 321839-75-2

SSR-125543, a potent CRF1 receptor non-peptide antagonist, effective in CAH research, taken orally.

Fórmula: C₂₇H₂₉Cl₂FN₂OS

Forma y color: Solid

Peso molecular: 519.501

Ref: TM-T40398

Crinecerfont (hydrochloride)

CAS: 321839-75-2

Fórmula: C₂₇H₂₉Cl₂FN₂OS

Pureza: 98%

Peso molecular: 519.5014

Ref: IN-DA00CNJI

Crinecerfont hydrochloride

CAS: 321839-75-2

Crinecerfont hydrochloride is a pharmacological agent categorized as a selective corticotropin-releasing factor type 1 (CRF1) receptor antagonist. This compound is synthesized through advanced organic chemistry methodologies, deriving from a series of chemical modifications designed to achieve specificity for the CRF1 receptor.

Fórmula: C₂₇H₂₉Cl₂FN₂OS

Pureza: Min. 95%

Peso molecular: 519.5 g/mol

Ref: 3D-WMA83975