CAS 374703-78-3

Fórmula: C13H11N3OS

InChI: InChI=1S/C13H11N3OS/c1-7-9(6-11-12(17)16-13(18)15-11)8-4-2-3-5-10(8)14-7/h2-6,17H,1H3,(H2,15,16,18)/b9-6+

Clave InChI: BPJCCABLAZZIEJ-RMKNXTFCSA-N

SMILES: CC\1=NC2=CC=CC=C2/C1=C/C3=C(NC(=S)N3)O

PKG drug G1

CAS: 374703-78-3

PKG drug G1

Fórmula: C₁₃H₁₁N₃OS

Pureza: 97.5%

Peso molecular: 257.31

Ref: 54-BUP13117

5-((2-Methyl-1H-indol-3-yl)methylene)-2-thioxoimidazolidin-4-one

CAS: 374703-78-3

Fórmula: C₁₃H₁₁N₃OS

Pureza: 98%

Peso molecular: 257.3109

Ref: IN-DA01EO3T

PKG drug G1

CAS: 374703-78-3

PKG drug G1 targets PKG Iα C42. PKG drug G1 can couple to vasodilation and blood pressure lowering by a C42 PKG Iα-independent mechanism.

Fórmula: C₁₃H₁₁N₃OS

Pureza: 97.57% - 97.67%

Forma y color: Solid

Peso molecular: 257.311

Ref: TM-T4661

PKG drug G1

CAS: 374703-78-3

PKG drug G1 is a synthetic small-molecule inhibitor, which is a laboratory-engineered compound designed to interfere with the signaling pathways involved in cell cycle regulation. It is specifically sourced through chemical synthesis, allowing for precise modifications to enhance its stability and efficacy in cellular systems. The mode of action of PKG drug G1 involves selectively targeting and inhibiting certain protein kinases that play a crucial role in the progression of the cell cycle, particularly the G1 phase. By inhibiting these kinases, the drug effectively halts cell division, making it a potential candidate for research in cancer treatment.

Fórmula: C₁₃H₁₁N₃OS

Pureza: Min. 95%

Peso molecular: 257.31 g/mol

Ref: 3D-ZPA70378