CAS 476630-49-6

Fórmula: C20H26O5

InChI: InChI=1S/C20H26O5/c1-5-15(11-21)20(23)25-17-10-13(3)8-6-7-12(2)9-16-18(17)14(4)19(22)24-16/h5,8-9,16-18,21H,4,6-7,10-11H2,1-3H3/b12-9+,13-8+,15-5-/t16-,17-,18+/m1/s1

Clave InChI: LQAWDKQOLJURMN-DUROQTLYSA-N

SMILES: C/C=C(/CO)\C(=O)O[C@@H]1C/C(=C/CC/C(=C/[C@@H]2[C@@H]1C(=C)C(=O)O2)/C)/C

Eupaglehnin C

CAS: 476630-49-6

Eupaglehnin C shows cytotoxic (2.19 mg/ml) against HeLa-S3.

Fórmula: C₂₀H₂₆O₅

Pureza: 98%

Forma y color: Solid

Peso molecular: 346.423

Ref: TM-TN4034

Eupaglehnin C

CAS: 476630-49-6

Fórmula: C₂₀H₂₆O₅

Pureza: 95%~99%

Peso molecular: 346.423

Ref: BP-SBP04148

Eupaglehnin C

CAS: 476630-49-6

Eupaglehnin C is a chemical compound classified as a natural alkaloid. It is derived from the plant species *Eupatorium adenophorum*, commonly known as Crofton weed. This plant source is notable for its diverse secondary metabolites, which include various biologically active compounds. Eupaglehnin C exerts its effects through modulating cellular pathways involved in cancer progression, particularly influencing apoptosis and cell cycle arrest. Its molecular mechanism targets specific signaling routes that are overactive in malignancies, effectively disrupting tumor growth and proliferation.

Fórmula: C₂₀H₂₆O₅

Pureza: Min. 95%

Peso molecular: 346.4 g/mol

Ref: 3D-BUA63049