CAS 477873-63-5

Fórmula: C16H22O9

InChI: InChI=1S/C16H22O9/c1-23-9-4-2-8(3-5-12(18)19)10(6-9)24-16-15(22)14(21)13(20)11(7-17)25-16/h2,4,6,11,13-17,20-22H,3,5,7H2,1H3,(H,18,19)/t11-,13-,14+,15-,16-/m1/s1

Clave InChI: LIVNOUBJFOXZOR-YMILTQATSA-N

SMILES: COC1=CC(=C(C=C1)CCC(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O

3-(2-Glucosyloxy-4-methoxyphenyl)propanoic acid

CAS: 477873-63-5

Fórmula: C₁₆H₂₂O₉

Pureza: 97.0%

Peso molecular: 358.3405

Ref: IN-DA00DK0D

3-(2-Glucosyloxy-4-methoxyphenyl)propanoic acid

CAS: 477873-63-5

2-O-beta-d-Glucosyloxy-4-methoxybenzenepropanoic acid inhibits GST and acts as an antifungal.

Fórmula: C₁₆H₂₂O₉

Pureza: 98%

Forma y color: Solid

Peso molecular: 358.34

Ref: TM-TN2849

3-(2-Glucosyloxy-4-methoxyphenyl)propanoic acid

CAS: 477873-63-5

Fórmula: C₁₆H₂₂O₉

Pureza: 95%~99%

Peso molecular: 358.343

Ref: BP-SBP03427

3-(2-Glucosyloxy-4-methoxyphenyl)propanoic acid

CAS: 477873-63-5

3-(2-Glucosyloxy-4-methoxyphenyl)propanoic acid is a phenolic acid derivative, which is a type of organic compound known for its bioactive properties. This compound is typically sourced from plant materials, where it naturally occurs as part of the plant's defense mechanisms and contributes to the plant's overall resilience.

Fórmula: C₁₆H₂₂O₉

Pureza: Min. 95%

Peso molecular: 358.34 g/mol

Ref: 3D-CUA87363