CAS 508-71-4

Fórmula: C20H28O3

InChI: InChI=1S/C20H28O3/c1-5-17(2)9-10-19(4)13(12-17)14(21)11-15-18(3)7-6-8-20(15,19)23-16(18)22/h5,13,15H,1,6-12H2,2-4H3/t13-,15-,17+,18-,19+,20+/m0/s1

Clave InChI: HWECMADGHQKSLK-BWXAORSUSA-N

SMILES: C[C@]1(CC[C@@]2([C@@H](C1)C(=O)C[C@@H]3[C@]24CCC[C@@]3(C(=O)O4)C)C)C=C

Rosenonolactone

CAS: 508-71-4

Rosenonolactone shows inhibitory activity against prolyl endopeptidase and thrombin.

Fórmula: C₂₀H₂₈O₃

Pureza: 98%

Forma y color: Solid

Peso molecular: 316.441

Ref: TM-TN4917

Rosenonolactone

CAS: 508-71-4

Rosenonolactone is a sesquiterpene lactone that is derived from certain plant species. This compound is sourced from plants belonging to the Daisies family, known for their diverse range of secondary metabolites that exhibit various bioactive properties. The mode of action of rosenonolactone involves the inhibition of specific enzymes or signaling pathways, which can result in alterations to cellular processes or inhibition of pathogen growth.

Fórmula: C₂₀H₂₈O₃

Pureza: Min. 95%

Peso molecular: 316.4 g/mol

Ref: 3D-AAA50871