CAS 5084-31-1

Fórmula: C13H8O6

InChI: InChI=1S/C13H8O6/c14-5-3-8(16)10-9(4-5)19-13-6(11(10)17)1-2-7(15)12(13)18/h1-4,14-16,18H

Clave InChI: CCEBJWKUMKKCDF-UHFFFAOYSA-N

SMILES: C1=CC(=C(C2=C1C(=O)C3=C(C=C(C=C3O2)O)O)O)O

1,3,5,6-Tetrahydroxyxanthone

CAS: 5084-31-1

1,3,5,6-Tetrahydroxyxanthone is a natural xanthone with hepatoprotective and ACE inhibitory activities (EC₅₀ = 160.2 µM for HepG2 protection).

Fórmula: C₁₃H₈O₆

Pureza: 98.83%

Forma y color: Solid

Peso molecular: 260.199

Ref: TM-TN2487

1,3,5,6-Tetrahydroxyxanthone

CAS: 5084-31-1

1,3,5,6-Tetrahydroxyxanthone is a polyphenolic compound, typically classified as a naturally occurring xanthone derivative. It is predominantly sourced from various plants, particularly those within the Gentianaceae and Clusiaceae families, where it is found as part of the secondary metabolite profiles of these species. This compound exhibits its mode of action primarily through antioxidant mechanisms, which involve the scavenging of free radicals and the reduction of oxidative stress within biological systems.

Fórmula: C₁₃H₈O₆

Pureza: Min. 95%

Peso molecular: 260.20 g/mol

Ref: 3D-FAA08431