CAS 50875-24-6

Fórmula: C18H14O6

InChI: InChI=1S/C18H14O6/c1-18(2)4-3-9-14-13(7-11(21)17(9)24-18)23-12-6-8(19)5-10(20)15(12)16(14)22/h3-7,19-21H,1-2H3

Clave InChI: MFKYNKVEQUTJEH-UHFFFAOYSA-N

SMILES: CC1(C=CC2=C(O1)C(=CC3=C2C(=O)C4=C(C=C(C=C4O3)O)O)O)C

Toxyloxanthone B

CAS: 50875-24-6

Toxyloxanthone B is a useful organic compound for research related to life sciences and the catalog number is T124748.

Fórmula: C₁₈H₁₄O₆

Forma y color: Solid

Peso molecular: 326.30

Ref: TM-T124748

Toxyloxanthone B

CAS: 50875-24-6

Toxyloxanthone B is a bioactive compound, specifically a xanthone derivative, categorized under secondary metabolites produced by certain fungi. This compound is derived from the natural metabolic processes of these microorganisms, often isolated from marine or soil-based fungal species. It represents a fascinating intersection of natural product chemistry and pharmacology.

Fórmula: C₁₈H₁₄O₆

Pureza: Min. 95%

Peso molecular: 326.3 g/mol

Ref: 3D-ACA87524