CAS 509077-91-2

Fórmula: C32H24O10

InChI: InChI=1S/C32H24O10/c1-15-20(34)11-25-28(30(15)37)21(35)12-24(41-25)17-5-9-19(10-6-17)40-32-27(39-2)14-26-29(31(32)38)22(36)13-23(42-26)16-3-7-18(33)8-4-16/h3-11,13-14,24,33-34,37-38H,12H2,1-2H3/t24-/m0/s1

Clave InChI: KFJPGGGJZYXVJH-DEOSSOPVSA-N

SMILES: CC1=C(C2=C(C=C1O)O[C@@H](CC2=O)C3=CC=C(C=C3)OC4=C(C=C5C(=C4O)C(=O)C=C(O5)C6=CC=C(C=C6)O)OC)O

Taiwanhomoflavone B

CAS: 509077-91-2

Taiwanhomoflavone B is cytotoxic with ED(50) values of 3.8 and 3.5 microg/ml, against KB oral epidermoid carcinoma and Hepa-3B hepatoma cells, respectively.

Fórmula: C₃₂H₂₄O₁₀

Pureza: 98%

Forma y color: Solid

Peso molecular: 568.534

Ref: TM-TN5446

Taiwanhomoflavone B

CAS: 509077-91-2

Taiwanhomoflavone B is a bioactive compound belonging to the class of biflavonoids. It is sourced from Selaginella species, a group of ancient spore-producing vascular plants widely distributed in tropical regions. The mode of action of taiwanhomoflavone B involves various biochemical pathways, including free radical scavenging, modulation of enzyme activity, and interaction with cellular signaling pathways. These mechanisms contribute to its potential anti-inflammatory, antioxidant, and anticancer properties.

Fórmula: C₃₂H₂₄O₁₀

Pureza: Min. 95%

Peso molecular: 568.5 g/mol

Ref: 3D-JVA07791