CAS 509078-16-4

Fórmula: C22H32O6

InChI: InChI=1S/C22H32O6/c1-8-12(2)20(25)27-19-9-13(3)22(26)11-18(24)14(4)16(22)10-17(19)21(6,7)28-15(5)23/h8,13,17,19,26H,9-11H2,1-7H3/b12-8-/t13-,17-,19+,22-/m0/s1

Clave InChI: YSHITMOTGBUVPS-CKPVPAQKSA-N

SMILES: C/C=C(/C)\C(=O)O[C@@H]1C[C@@H]([C@]2(CC(=O)C(=C2C[C@@H]1C(C)(C)OC(=O)C)C)O)C

1β-Hydroxytorilin

CAS: 509078-16-4

1beta-Hydroxytorilin exhibits cytotoxicity against human A549, SK-OV-3, SK-MEL-2, and HCT15 tumor cells.

Fórmula: C₂₂H₃₂O₆

Pureza: 98%

Forma y color: Solid

Peso molecular: 392.49

Ref: TM-TN2669

1β-Hydroxytorilin

CAS: 509078-16-4

Fórmula: C₂₂H₃₂O₆

Pureza: 95%~99%

Peso molecular: 392.492

Ref: BP-SBP03389

1β-Hydroxytorilin

CAS: 509078-16-4

1β-Hydroxytorilin is a natural compound, specifically a sesquiterpene lactone, which is derived from plant sources, particularly from certain species within the Umbelliferae family. Its mode of action involves modulation of various biochemical pathways, often targeting specific enzymes or receptors, thereby influencing cellular responses. This compound has demonstrated a range of biological activities in preliminary studies, such as anti-inflammatory and potential anti-cancer properties, through mechanisms like inhibition of pro-inflammatory cytokine production and interference with cell proliferation pathways.

Fórmula: C₂₂H₃₂O₆

Pureza: Min. 95%

Peso molecular: 392.5 g/mol

Ref: 3D-JVA07816