CAS 512809-77-7

Fórmula: C11H11N3O4

InChI: InChI=1S/C11H11N3O4/c1-7-11(14(16)17)8(2)13(12-7)5-9-3-4-10(6-15)18-9/h3-4,6H,5H2,1-2H3

Clave InChI: IJNGVKGADNONOL-UHFFFAOYSA-N

SMILES: CC1=C(C(=NN1CC2=CC=C(O2)C=O)C)[N+](=O)[O-]

5-[(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]furan-2-carbaldehyde

CAS: 512809-77-7

5-[(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl]furan-2-carbaldehyde (MFA) is a nucleophilic reagent that can be used to introduce the triflate group into organic molecules. MFA is prepared by reacting 5-(hydroxymethyl)furfural with methanesulfonyl chloride in the presence of triethylamine. This compound has been used to study DNA methylation, as well as reactions involving sulfonates and mesylates. br>br> The MFA molecule has a nucleophilic hydroxymethyl group that reacts with electron withdrawing groups such as trifluoromethanesulfonate and methanesulfonyl chloride. The electron donating hydroxymethyl group can also react with electron withdrawing groups such as tosylate and sulfonate, which have an electrophilic carbonyl carbon atom

Fórmula: C₁₁H₁₁N₃O₄

Pureza: Min. 95%

Peso molecular: 249.22 g/mol

Ref: 3D-MVA80977