CAS 62893-37-2

Fórmula: C8H7N3O2

InChI: InChI=1S/C8H7N3O2/c9-11-10-7-3-1-6(2-4-7)5-8(12)13/h1-4H,5H2,(H,12,13)

Clave InChI: QQKGBHZEZFKXGO-UHFFFAOYSA-N

SMILES: C1=CC(=CC=C1CC(=O)O)N=[N+]=[N-]

(4-azidophenyl)acetic acid

CAS: 62893-37-2

(4-azidophenyl)acetic acid

Fórmula: C₈H₇N₃O₂

Pureza: >99%

Forma y color: Solid-Powder

Peso molecular: 177.16007

Ref: 54-BIBP1070

4-Azidobenzeneacetic acid

CAS: 62893-37-2

Fórmula: C₈H₇N₃O₂

Pureza: 95%

Peso molecular: 177.1601

Ref: IN-DA00JKI1

2-(4-azidophenyl)acetic acid

CAS: 62893-37-2

Fórmula: C₈H₇N₃O₂

Pureza: 95%

Forma y color: Solid, No data available.

Peso molecular: 177.163

Ref: 10-F402247

(4-Azidophenyl)acetic acid

CAS: 62893-37-2

4-Azidophenylacetic acid is a glutamate receptor antagonist that has been shown to be selective for the AMPA receptor. It has been shown to inhibit the production of inflammatory mediators, such as prostaglandin E2, from cells by inhibiting COX-2. 4-Azidophenylacetic acid also inhibits the binding of glutamate to its receptors and blocks NMDA receptors. The compound has been shown to be biodegradable, due to its reversible binding with proteins and nucleic acids. This drug has shown inhibitory potency against COX-2 and is being developed as an anti-inflammatory drug.

Fórmula: C₈H₇N₃O₂

Pureza: Min. 95%

Peso molecular: 177.16 g/mol

Ref: 3D-MCA89337

N3-PhAc-OH

CAS: 62893-37-2

N3-PhAc-OH is a click chemistry reagent featuring an azide group. Applied across various research fields due to its high yield, specificity, and simplicity, click chemistry shows tremendous potential in linking nucleic acids, lipids, proteins, and other molecules.

Fórmula: C₈H₇N₃O₂

Forma y color: Solid

Peso molecular: 177.1601

Ref: TM-T89713