CAS 62956-47-2

Fórmula: C28H34O9

InChI: InChI=1S/C28H34O9/c1-9-14(2)27(29)37-26-17-12-19-23(36-13-35-19)25(34-8)21(17)20-16(10-15(3)28(26,4)30)11-18(31-5)22(32-6)24(20)33-7/h9,11-12,15,26,30H,10,13H2,1-8H3/b14-9-/t15-,26-,28-/m0/s1

Clave InChI: ZIBVHHLTJKYXEB-RZGKOBFOSA-N

SMILES: C/C=C(/C)\C(=O)O[C@H]1C2=CC3=C(C(=C2C4=C(C(=C(C=C4C[C@@H]([C@]1(C)O)C)OC)OC)OC)OC)OCO3

Gomisin F

CAS: 62956-47-2

Gomisin F is a natural product of Schisandra, Schisandraceae.

Fórmula: C₂₈H₃₄O₉

Pureza: 98%

Forma y color: Solid

Peso molecular: 514.5642

Ref: TM-TN4152

Gomisin F

CAS: 62956-47-2

Gomisin F is a lignan compound, which is derived from the fruit of the plant Schisandra chinensis. This bioactive compound is known for its diverse pharmacological properties, attributed to its unique molecular structure. Its mode of action involves modulation of various biochemical pathways, including antioxidant mechanisms, enzyme inhibition, and receptor interactions. Gomisin F has been shown to interact with cellular antioxidant defenses, primarily through the upregulation of antioxidant enzymes and the scavenging of free radicals. Additionally, it has been observed to affect signaling pathways related to cellular proliferation and apoptosis.

Fórmula: C₂₈H₃₄O₉

Pureza: Min. 95%

Peso molecular: 514.60 g/mol

Ref: 3D-MCA95647