CAS 65473-08-7

Fórmula: C21H21N

InChI: InChI=1S/C21H21N/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20/h2-15H,16-17H2,1H3/b11-8-

Clave InChI: OZGNYLLQHRPOBR-FLIBITNWSA-N

SMILES: CN(C/C=C\C1=CC=CC=C1)CC2=CC=CC3=CC=CC=C32

(Z)-Naftifine

Producto controlado

CAS: 65473-08-7

Applications (Z)-Naftifine is the Z-isomer of Naftifine (N213100); an antimycotic allylamine and antifungal (topical) agent.
References Georgopoulos, A., et al.: Antimicrob. Ag. Chemother., 19, 386 (1981); Meingassner, J.C., et al.: J. Invest. Dermatol., 77, 444 (1981); Paltauf, F., et al.: Biochim Biophys. Acta, 712, 268 (1982); Aggarwal, D., et al.: J. Pharm. Pharmacol., 56, 1509 (2004)

Fórmula: C₂₁H₂₁N

Forma y color: Neat

Peso molecular: 287.4

Ref: TR-N213105

(Z)-Naftifine

CAS: 65473-08-7

(Z)-Naftifine is an antifungal agent, which is a synthetic compound with a unique chemical structure. This compound is derived through chemical synthesis, rather than being isolated from natural sources. Its mode of action involves inhibiting the enzyme squalene epoxidase, a crucial component in the biosynthesis of ergosterol, an essential sterol in fungal cell membranes. This inhibition leads to a deficit in ergosterol, disrupting cell membrane integrity and ultimately causing fungal cell death.

Fórmula: C₂₁H₂₁N

Pureza: Min. 95%

Peso molecular: 287.4 g/mol

Ref: 3D-QCA47308