CAS 65515-33-5

Fórmula: C7H6ClNO3

InChI: InChI=1S/C7H6ClNO3/c1-12-6-4(7(10)11)2-3-5(8)9-6/h2-3H,1H3,(H,10,11)

Clave InChI: BWEDPOXJDWAJGX-UHFFFAOYSA-N

SMILES: COC1=C(C=CC(=N1)Cl)C(=O)O

6-Chloro-2-methoxypyridine-3-carboxylic acid

CAS: 65515-33-5

6-Chloro-2-methoxypyridine-3-carboxylic acid

Fórmula: C₇H₆ClNO₃

Pureza: tech

Forma y color: Solid

Peso molecular: 187.58044

Ref: 54-OR303752

6-Chloro-2-methoxynicotinic acid

CAS: 65515-33-5

Fórmula: C₇H₆ClNO₃

Pureza: 98%

Forma y color: Solid

Peso molecular: 187.5804

Ref: IN-DA0038K4

6-Chloro-2-methoxynicotinic acid

CAS: 65515-33-5

6-Chloro-2-methoxynicotinic acid

Fórmula: C₇H₆ClNO₃

Pureza: 98%

Peso molecular: 187.58

Ref: IN-DG208788

6-Chloro-2-methoxynicotinic acid

CAS: 65515-33-5

Fórmula: C₇H₆ClNO₃

Pureza: 98%

Forma y color: Liquid

Peso molecular: 187.58

Ref: 10-F217986

6-Chloro-2-methoxynicotinic acid

CAS: 65515-33-5

6-Chloro-2-methoxynicotinic acid is a ketone that reacts with chlorine in the presence of light to form chlorinated products. It is a versatile intermediate for the synthesis of various compounds. 6-Chloro-2-methoxynicotinic acid is used in the synthesis of naphthacene, which is a precursor to dyes and pharmaceuticals. The reactivity of this compound depends on substituents located at the 2 position. Substituents cause sterically hindering effects and lead to different geometries and reactivities, such as attack by chlorine or substitution by hydrogen.

Fórmula: C₇H₆ClNO₃

Pureza: Min. 95%

Peso molecular: 187.58 g/mol

Ref: 3D-QCA51533