CAS 6563-66-2

Fórmula: C16H12O6

InChI: InChI=1S/C16H12O6/c1-21-9-4-2-8(3-5-9)12-6-10(17)14-13(22-12)7-11(18)15(19)16(14)20/h2-7,18-20H,1H3

Clave InChI: XVMMEYCPXZYLAI-UHFFFAOYSA-N

SMILES: COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C(=C3O)O)O

5,6,7-Trihydroxy-4'-methoxyflavone

CAS: 6563-66-2

5,6,7-Trihydroxy-4'-methoxyflavone

Fórmula: C₁₆H₁₂O₆

Pureza: ≥98%

Peso molecular: 300.27

Ref: 54-BUP22617

4H-1-Benzopyran-4-one, 5,6,7-trihydroxy-2-(4-methoxyphenyl)-

CAS: 6563-66-2

Pureza: 95%

Ref: IN-DA01GX8O

5,6,7-Trihydroxy-4'-methoxyflavone

CAS: 6563-66-2

5,6,7-Trihydroxy-4'-methoxyflavone is an antioxidant natural product exhibiting an IC₅₀ of 25.29 μM in DPPH radical scavenging activity assays on PC12 cells.

Fórmula: C₁₆H₁₂O₆

Pureza: 99.20%

Forma y color: Yellow Solid

Peso molecular: 300.27

Ref: TM-T124460

5,6,7-Trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one

CAS: 6563-66-2

5,6,7-Trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one is a molecule that has electronic transitions in the visible region of the spectrum. The absorptions are due to transitions between different energy levels or orbitals. The molecule has a geometry optimized for these transitions. Computational modeling of the molecule was performed by extracting density from quantum chemistry calculations and density functional theory (DFT) calculations in order to create a model with accurate potential energies. This theoretical approach was used to compute the highest occupied molecular orbital (HOMO) and lowest unoccupied molecular orbital (LUMO) energies for 5,6,7-Trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one. These computations were compared to experimental values obtained with gas phase experiments and molecular orbital calculations, which show good agreement.

Fórmula: C₁₆H₁₂O₆

Pureza: 85%

Forma y color: Powder

Peso molecular: 300.26 g/mol

Ref: 3D-GAA56366