CAS 68799-38-2

Fórmula: C15H22O3

InChI: InChI=1S/C15H22O3/c1-10-4-6-14(12(3)15(17)18)9-8-13(10)7-5-11(2)16/h8,10,14H,3-7,9H2,1-2H3,(H,17,18)/t10-,14+/m0/s1

Clave InChI: NIQIMYXBAQAIAT-IINYFYTJSA-N

SMILES: C[C@H]1CC[C@H](CC=C1CCC(=O)C)C(=C)C(=O)O

2-[(1R,5S)-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoic acid

CAS: 68799-38-2

2-[(1R,5S)-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoic acid

Fórmula: C₁₅H₂₂O₃

Pureza: ≥95%

Peso molecular: 250.33

Ref: 54-OR1125583

2-[(1R,5S)-5-methyl-4-(3-oxobutyl)cyclohept-3-en-1-yl]prop-2-enoic acid

CAS: 68799-38-2

Fórmula: C₁₅H₂₂O₃

Pureza: 95%

Peso molecular: 250.3334

Ref: IN-DA00FEOJ

4-Oxobedfordiaic acid

CAS: 68799-38-2

4-Oxobedfordiaic acid is a natural product for research related to life sciences. The catalog number is TN3066 and the CAS number is 68799-38-2.

Fórmula: C₁₅H₂₂O₃

Pureza: 98%

Forma y color: Solid

Peso molecular: 250.33

Ref: TM-TN3066

4-Oxobedfordiaic acid

CAS: 68799-38-2

Fórmula: C₁₅H₂₂O₃

Pureza: 95%~99%

Forma y color: Cryst.

Peso molecular: 250.338

Ref: BP-SBP00756

4-Oxobedfordiaic acid

CAS: 68799-38-2

4-Oxobedfordiaic acid is a specialized natural product, classified as a polyketide antibiotic, which is synthesized by certain bacterial strains in the genus *Streptomyces* or similar actinobacteria. This compound's unique antimicrobial properties arise from its ability to inhibit bacterial cell wall synthesis, thereby disrupting essential cellular processes in susceptible microorganisms.

Fórmula: C₁₅H₂₂O₃

Pureza: Min. 95%

Peso molecular: 250.33 g/mol

Ref: 3D-TCA79938