CAS 755036-41-0

Fórmula: C14H12N2O4

InChI: InChI=1S/C14H12N2O4/c17-6-11(18)13-12-8(5-10(16-13)14(19)20)7-3-1-2-4-9(7)15-12/h1-5,11,15,17-18H,6H2,(H,19,20)/t11-/m0/s1

Clave InChI: PKSXEHHRROSXPR-NSHDSACASA-N

SMILES: C1=CC=C2C(=C1)C3=CC(=NC(=C3N2)[C@H](CO)O)C(=O)O

Dichotomine B

CAS: 755036-41-0

Dichotomine B

Fórmula: C₁₄H₁₂N₂O₄

Pureza: ≥95%

Peso molecular: 272.26

Ref: 54-BUP22321

Dichotomine B

CAS: 755036-41-0

Pureza: 98%

Ref: IN-DA01V4CF

Dichotomine B

CAS: 755036-41-0

Dichotomine B is a natural alkaloid modulating the TLR4/MyD88-mTOR pathway, attenuating neuroinflammatory responses in LPS/ATP-induced BV2 microglia.

Fórmula: C₁₄H₁₂N₂O₄

Pureza: 98%

Forma y color: Yellow Solid

Peso molecular: 272.26

Ref: TM-TN6513

Dichotomine B

CAS: 755036-41-0

Fórmula: C₁₄H₁₂N₂O₄

Pureza: 95%~99%

Peso molecular: 272.26

Ref: BP-BP5593

Dichotomine B

CAS: 755036-41-0

Dichotomine B is an alkaloid compound, which is a microbial metabolite known for its bioactive properties. It is derived primarily from bacterial or fungal sources, where it is produced as part of the organism's secondary metabolite pathways. The mode of action of Dichotomine B involves interaction with bacterial cellular processes, leading to disruption of critical metabolic pathways and ultimately exerting antibacterial effects.

Fórmula: C₁₄H₁₂N₂O₄

Pureza: Min. 95%

Peso molecular: 272.26 g/mol

Ref: 3D-FFB03641