CAS 7552-55-8

Fórmula: C6H4F2O4S2

InChI: InChI=1S/C6H4F2O4S2/c7-13(9,10)5-2-1-3-6(4-5)14(8,11)12/h1-4H

Clave InChI: VCINFPPPNNZOAD-UHFFFAOYSA-N

SMILES: C1=CC(=CC(=C1)S(=O)(=O)F)S(=O)(=O)F

1,3-Benzenedisulfonyl fluoride

CAS: 7552-55-8

Fórmula: C₆H₄F₂O₄S₂

Pureza: 98%

Forma y color: Solid

Peso molecular: 242.2204

Ref: IN-DA00ICN6

Benzene-1,3-disulfonyl fluoride

CAS: 7552-55-8

Benzene-1,3-disulfonyl fluoride

Fórmula: C₆H₄F₂O₄S₂

Pureza: 95%

Forma y color: Solid

Peso molecular: 242.22036

Ref: 54-PC520783

Benzene-1,3-disulfonyl fluoride

CAS: 7552-55-8

Pureza: 98%

Forma y color: Solid

Peso molecular: 242.2100067

Ref: 10-F955509

Benzene-1,3-disulfonyl fluoride

CAS: 7552-55-8

Benzene-1,3-disulfonyl fluoride is a reagent that can be used in organic synthesis. It can be used to synthesize carboxylic acids and amides from carboxylic acid chlorides and amines. This agent yields high yields of functional groups with little or no steric hindrance. Benzene-1,3-disulfonyl fluoride is also a strong nucleophile that can react with amine to form an intermediate which reacts with another molecule of benzene-1,3-disulfonyl fluoride to form the desired product. As a nucleophile, it is reactive toward biological molecules such as proteins and DNA.

Fórmula: C₆H₄F₂O₄S₂

Pureza: Min. 95%

Peso molecular: 242.22 g/mol

Ref: 3D-HAA55255