CAS 757202-11-2

Fórmula: C20H24O7

InChI: InChI=1S/C20H24O7/c1-9(4-5-21)18(22)26-13-7-20(24)8-25-12-6-10(2)14(16(12)20)17-15(13)11(3)19(23)27-17/h4,6,12-17,21,24H,3,5,7-8H2,1-2H3/b9-4+/t12-,13-,14+,15-,16-,17-,20+/m1/s1

Clave InChI: QWNQZWRFKIHTPL-NPUYJLKLSA-N

SMILES: CC1=C[C@@H]2[C@@H]3[C@H]1[C@@H]4[C@@H]([C@@H](C[C@@]3(CO2)O)OC(=O)/C(=C/CO)/C)C(=C)C(=O)O4

Eupalinilide C

CAS: 757202-11-2

Eupalinilide C is a natural product from Impatiens balsamina L.

Fórmula: C₂₀H₂₄O₇

Pureza: 98%

Forma y color: Solid

Peso molecular: 376.405

Ref: TM-TN1629

Eupalinilide C

CAS: 757202-11-2

Fórmula: C₂₀H₂₄O₇

Pureza: 95%~99%

Peso molecular: 376.405

Ref: BP-BP0572

Eupalinilide C

CAS: 757202-11-2

Eupalinilide C is a naturally derived sesquiterpene lactone, which is isolated from the plant Eupatorium lindleyanum. It possesses a unique molecular structure that enables it to interact with specific biological targets. The mode of action primarily involves binding to tubulin, thereby inhibiting microtubule polymerization and disrupting cell division. This mechanism is critical in its interference with the growth and replication of cancer cells, lending it potential efficacy in oncological applications.

Fórmula: C₂₀H₂₄O₇

Pureza: Min. 95%

Peso molecular: 376.4 g/mol

Ref: 3D-HFB20211