CAS 78749-47-0

Fórmula: C15H18O3

InChI: InChI=1S/C15H18O3/c1-7-8-3-12-10(6-16)9-4-11(9)15(12,2)5-13(8)18-14(7)17/h5,9-12,16H,3-4,6H2,1-2H3/t9-,10-,11-,12+,15+/m1/s1

Clave InChI: XZHCTKZHBRTLRU-CYRTVHNOSA-N

SMILES: CC1=C2C[C@H]3[C@@H]([C@H]4C[C@H]4[C@@]3(C=C2OC1=O)C)CO

Shizukanolide C

CAS: 78749-47-0

Fórmula: C₁₅H₁₈O₃

Peso molecular: 246.3016

Ref: IN-DA00G8DA

Shizukanolide C

CAS: 78749-47-0

Shizukanolide C diterpenoid from Brucea javanica for phytochemical analysis, natural product pharmacology and diterpenoid biochemical research.

Fórmula: C₁₅H₁₈O₃

Pureza: 98%

Forma y color: Solid

Peso molecular: 246.30

Ref: TM-TN5007

Shizukanolide C

CAS: 78749-47-0

Fórmula: C₁₅H₁₈O₃

Pureza: 95%~99%

Peso molecular: 246.306

Ref: BP-SBP03168

Shizukanolide C

CAS: 78749-47-0

Shizukanolide C is a sesquiterpene lactone, which is a class of naturally occurring organic compounds. This compound is isolated from the plant Chloranthus serratus, known for its presence in traditional medicinal systems. The mode of action of Shizukanolide C involves modulation of various biological pathways, including potential anti-inflammatory and anticancer activities. It is believed to interact with cellular targets that regulate inflammation and possibly inhibit pathways critical to cancer cell proliferation.

Fórmula: C₁₅H₁₈O₃

Pureza: Min. 95%

Peso molecular: 246.3 g/mol

Ref: 3D-DDA74947