CAS 82508-36-9

Fórmula: C20H24O7

InChI: InChI=1S/C20H24O7/c1-12(15(21)22)4-3-8-18(2)14-7-10-19(17(25)27-18)9-5-13(16(23)24)6-11-20(14,19)26/h3-5,8,14,26H,6-7,9-11H2,1-2H3,(H,21,22)(H,23,24)/b8-3+,12-4+/t14-,18+,19+,20-/m0/s1

Clave InChI: QPFFEVMIQIJTGZ-XYWPTNBISA-N

SMILES: C/C(=C\C=C\[C@@]1([C@@H]2CC[C@@]3([C@@]2(CCC(=CC3)C(=O)O)O)C(=O)O1)C)/C(=O)O

Demethoxydeacetoxypseudolaric acid B

CAS: 82508-36-9

Demethoxydeacetoxypseudolaric acid B

Fórmula: C₂₀H₂₄O₇

Pureza: 99.5%

Peso molecular: 376.4

Ref: 54-BUP00354

Demethylpseudolaric acid C

CAS: 82508-36-9

Fórmula: C₂₀H₂₄O₇

Pureza: 95%~99%

Peso molecular: 376.405

Ref: BP-BP0473

Demethoxydeacetoxypseudolaric acid B

CAS: 82508-36-9

Fórmula: C₂₀H₂₄O₇

Pureza: 99%

Peso molecular: 376.4004

Ref: IN-DA00G676

Demethoxydeacetoxypseudolaric acid B

CAS: 82508-36-9

Demethoxydeacetoxypseudolaric acid B's the metabolic reaction of TDA in vivo is mainly occurred in blood and contributes to be the hydrolysis of plasma esterase

Fórmula: C₂₀H₂₄O₇

Pureza: 99.91% - 99.93%

Forma y color: Solid

Peso molecular: 376.4004

Ref: TM-TN3820

Demethoxydeacetoxypseudolaric acid B

CAS: 82508-36-9

Demethoxydeacetoxypseudolaric acid B is a diterpenoid compound, which is derived from the roots of Pseudolarix amabilis, a plant native to China. Its mode of action involves disrupting microtubule functions by binding to tubulin, which inhibits cell division and possesses significant cytotoxic activity. This mechanism is similar to the action of well-known anticancer agents like taxol, making it an area of interest for therapeutic applications.

Fórmula: C₂₀H₂₄O₇

Pureza: Min. 95%

Peso molecular: 376.4 g/mol

Ref: 3D-HDA50836