CAS 83199-38-6

Fórmula: C20H24O7

InChI: InChI=1S/C20H24O7/c1-6-11(2)19(23)27-17(18(22)20(3,4)24)13-9-12-7-8-16(21)26-14(12)10-15(13)25-5/h6-10,17-18,22,24H,1-5H3/b11-6-/t17-,18-/m1/s1

Clave InChI: BAHUBXAYVOCLNA-FNYRBRLGSA-N

SMILES: C/C=C(/C)\C(=O)O[C@H](C1=C(C=C2C(=C1)C=CC(=O)O2)OC)[C@H](C(C)(C)O)O

Angelol G

CAS: 83199-38-6

Angelol G

Peso molecular: 376.15

Ref: 10-F566296

Angelol G

CAS: 83199-38-6

Angelol G

Fórmula: C₂₀H₂₄O₇

Pureza: ≥98%

Peso molecular: 376.4

Ref: 54-OR1223488

Angelol G

CAS: 83199-38-6

Angelol G is a natural product from Angelica sinensis.

Fórmula: C₂₀H₂₄O₇

Pureza: 98%

Forma y color: Solid

Peso molecular: 376.4004

Ref: TM-TN3414

Angelol G

CAS: 83199-38-6

Pureza: 98%

Ref: IN-DA01V4X0

Angelol G

CAS: 83199-38-6

Angelol G is a natural product, specifically a coumarin derivative, which is derived from certain plant species, particularly those in the Angelica genus. These plants have been traditionally used in herbal medicine and are known for their bioactive compounds. Angelol G exerts its effects primarily through modulation of various biological pathways, including anti-inflammatory and antioxidant actions. Its mode of action involves the inhibition of specific enzymes and the neutralization of free radicals, contributing to cellular protection and homeostasis.

Fórmula: C₂₀H₂₄O₇

Pureza: Min. 95%

Peso molecular: 376.40 g/mol

Ref: 3D-IDA19938