CAS 871347-98-7

Fórmula: C17H24O6

InChI: InChI=1S/C17H24O6/c1-17(2)22-15-14(20-10-11-6-4-3-5-7-11)13(8-12(19)9-18)21-16(15)23-17/h3-7,12-16,18-19H,8-10H2,1-2H3

Clave InChI: HEWMYHHOHKYSQS-UHFFFAOYSA-N

SMILES: CC1(OC2C(C(OC2O1)CC(CO)O)OCC3=CC=CC=C3)C

(S)-3-((3aR,5R,6S,6aR)-6-(Benzyloxy)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)propane-1,2-diol

CAS: 871347-98-7

(S)-3-((3aR,5R,6S,6aR)-6-(Benzyloxy)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)propane-1,2-diol is a guanosine triphosphatase inhibitor that binds to the enzyme and blocks its activity. It also has anti-cancer properties due to its ability to inhibit DNA methylation. The drug is activated by nitro groups in the presence of formaldehyde or formic acid to give 3-(N-nitrosomethyl)benzoyloxymethyl butyrylguanine (NMGB). This metabolite is then hydrolyzed into an aldehyde and dialkylamino group which are thought to be responsible for the anticancer activity. NMGB inhibits cancer cell growth by inhibiting protein synthesis and reducing metabolic activities.

Fórmula: C₁₇H₂₄O₆

Pureza: Min. 95%

Peso molecular: 324.37 g/mol

Ref: 3D-MB45373