CAS 886989-88-4

Fórmula: C16H21NO4

InChI: InChI=1S/C16H21NO4/c1-19-13-10-12(11-14(20-2)16(13)21-3)6-7-15(18)17-8-4-5-9-17/h6-7,10-11H,4-5,8-9H2,1-3H3/b7-6+

Clave InChI: TYFKYDTUEMTUNY-VOTSOKGWSA-N

SMILES: COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)N2CCCC2

Piperlotine C

CAS: 886989-88-4

Piperlotine C

Fórmula: C₁₆H₂₁NO₄

Pureza: ≥98%

Peso molecular: 291.34

Ref: 54-OR1117207

Piperlotine C

CAS: 886989-88-4

Fórmula: C₁₆H₂₁NO₄

Pureza: 98%

Peso molecular: 291.3422

Ref: IN-DA00H09W

Piperlotine C

CAS: 886989-88-4

Piperlotine C shows potent antiplatelet aggregation activity.

Fórmula: C₁₆H₂₁NO₄

Pureza: 98%

Forma y color: Solid

Peso molecular: 291.34

Ref: TM-TN2087

PiperlotineC

CAS: 886989-88-4

Fórmula: C₁₆H₂₁NO₄

Peso molecular: 291.35

Ref: 7W-GY2566

PiperlotineC

CAS: 886989-88-4

Fórmula: C₁₆H₂₁NO₄

Pureza: 95%~99%

Peso molecular: 291.347

Ref: BP-SBP03063

Piperlotine C

CAS: 886989-88-4

Piperlotine C is a bioactive compound, which is derived from natural sources, specifically plants in the Piperaceae family. This compound exhibits numerous biological activities due to its unique molecular structure. Piperlotine C functions primarily by interacting with cellular pathways to modulate biological processes, showing potential for inhibiting specific enzymatic activities. These interactions can influence signaling cascades and metabolic pathways within the cell.

Fórmula: C₁₆H₂₁NO₄

Pureza: Min. 95%

Peso molecular: 291.34 g/mol

Ref: 3D-LKB98988