CAS 906794-56-7

Fórmula: C28H32O6

InChI: InChI=1S/C28H32O6/c1-14(2)7-10-17-13-20-25(32)21-24(31)18(11-8-15(3)4)23(30)19(12-9-16(5)6)27(21)34-28(20)26(33)22(17)29/h7-9,13,29-31,33H,10-12H2,1-6H3

Clave InChI: UVAAZIOBAWMBHC-UHFFFAOYSA-N

SMILES: CC(=CCC1=CC2=C(C(=C1O)O)OC3=C(C(=C(C(=C3C2=O)O)CC=C(C)C)O)CC=C(C)C)C

Parvifolixanthone A

CAS: 906794-56-7

Parvifolixanthone A is a natural product from Garcinia parvifolia.

Fórmula: C₂₈H₃₂O₆

Pureza: 98%

Forma y color: Solid

Peso molecular: 464.55

Ref: TM-TN4739

Parvifolixanthone A

CAS: 906794-56-7

Fórmula: C₂₈H₃₂O₆

Pureza: 95%~99%

Peso molecular: 464.558

Ref: BP-SBP04317

Parvifolixanthone A

CAS: 906794-56-7

Parvifolixanthone A is a xanthone compound, which is a class of polyphenolic compounds known for their diverse biological activities. This compound is derived from natural sources, specifically isolated from certain Garcinia species, which are tropical trees and shrubs known for their medicinal properties. Parvifolixanthone A demonstrates its mode of action through various biochemical pathways, including antioxidant, antimicrobial, and cytotoxic activities. It interacts at the molecular level, potentially modulating oxidative stress and inhibiting microbial growth through specific inhibition of target enzymes and cellular processes.

Fórmula: C₂₈H₃₂O₆

Pureza: Min. 95%

Peso molecular: 464.5 g/mol

Ref: 3D-GLB79456