CAS 922050-57-5

Fórmula: C13H8ClN5OS

InChI: InChI=1S/C13H8ClN5OS/c14-8-2-1-3-9(6-8)19-11-10(7-16-19)12(20)18-13(17-11)21-5-4-15/h1-3,6-7H,5H2,(H,17,18,20)

Clave InChI: DRTDDTWOOFJKOH-UHFFFAOYSA-N

SMILES: C1=CC(=CC(=C1)Cl)N2C3=C(C=N2)C(=O)NC(=N3)SCC#N

HS56

CAS: 922050-57-5

HS56 is an advanced biopolymer, which is derived from a proprietary synthesis of renewable sources. With its unique molecular configuration, this product stands out due to its sustainable origin and innovative production method. The mode of action involves its ability to form stable complexes with diverse substrates, which can enhance material properties such as strength, flexibility, and biodegradability.

Fórmula: C₁₃H₈ClN₅OS

Pureza: Min. 95%

Peso molecular: 317.75 g/mol

Ref: 3D-XLB05057

HS56

CAS: 922050-57-5

HS56: ATP-competitive Pim/DAPK3 inhibitor, Ki: DAPK3 (0.26μM), Pim-3 (0.208μM), Pim-1 (2.94μM), Pim-2 (>100μM), reduces hypertension in mice.

Fórmula: C₁₃H₈ClN₅OS

Forma y color: Solid

Peso molecular: 317.75

Ref: TM-T68341