CAS 93888-59-6

Fórmula: C15H22O3

InChI: InChI=1S/C15H22O3/c1-10(2)8-14(16)9-11(3)12-4-6-13(7-5-12)15(17)18/h6,9-10,12H,4-5,7-8H2,1-3H3,(H,17,18)/b11-9+/t12-/m0/s1

Clave InChI: IVWKCWHRLFIGCR-ZKQHCESOSA-N

SMILES: CC(C)CC(=O)/C=C(\C)/[C@@H]1CCC(=CC1)C(=O)O

9-Oxo-2,7-bisaboladien-15-oic acid

CAS: 93888-59-6

Fórmula: C₁₅H₂₂O₃

Pureza: 97.0%

Peso molecular: 250.3334

Ref: IN-DA00H0G2

9-Oxo-2,7-bisaboladien-15-oic acid

CAS: 93888-59-6

9-Oxo-2,7-bisaboladien-15-oic acid is a natural product for research related to life sciences. The catalog number is TN3328 and the CAS number is 93888-59-6.

Fórmula: C₁₅H₂₂O₃

Pureza: 98%

Forma y color: Solid

Peso molecular: 250.33

Ref: TM-TN3328

9-Oxo-2,7-bisaboladien-15-oic acid

CAS: 93888-59-6

Fórmula: C₁₅H₂₂O₃

Pureza: 95%~99%

Forma y color: Powder

Peso molecular: 250.338

Ref: BP-SBP00268

9-Oxo-2,7-bisaboladien-15-oic acid

CAS: 93888-59-6

9-Oxo-2,7-bisaboladien-15-oic acid is a bioactive compound, which is a naturally derived sesquiterpene acid. This compound is primarily sourced from certain plant species, where it occurs as a metabolite contributing to the plant's defense mechanisms. Its mode of action involves modulating inflammatory pathways, potentially by inhibiting specific enzymes or signaling molecules associated with the inflammatory response.

Fórmula: C₁₅H₂₂O₃

Pureza: Min. 95%

Peso molecular: 250.33 g/mol

Ref: 3D-TDA88859