CAS 949467-71-4

Fórmula: C26H48N8O2

InChI: InChI=1S/C26H48N8O2/c1-17(2)13-33(14-18(3)4)23-21-22(30-25(31-23)27-9-11-35)24(32-26(29-21)28-10-12-36)34(15-19(5)6)16-20(7)8/h17-20,35-36H,9-16H2,1-8H3,(H,27,30,31)(H,28,29,32)

Clave InChI: KIZLZYHFIWWKIL-UHFFFAOYSA-N

SMILES: CC(C)CN(CC(C)C)C1=NC(=NC2=C1N=C(N=C2N(CC(C)C)CC(C)C)NCCO)NCCO

TC-T 6000

CAS: 949467-71-4

TC-T 6000

Fórmula: C₂₆H₄₈N₈O₂

Pureza: ≥98%

Peso molecular: 504.71

Ref: 54-BUP21767

hENT4-IN-1

CAS: 949467-71-4

Fórmula: C₂₆H₄₈N₈O₂

Pureza: 98%

Peso molecular: 504.7117

Ref: IN-DA01ENLN

2,2'-((4,8-Bis(diisobutylamino)pyrimido[5,4-d]pyrimidine-2,6-diyl)bis(azanediyl))diethanol

CAS: 949467-71-4

Fórmula: C₂₆H₄₈N₈O₂

Pureza: 99%

Peso molecular: 504.71

Ref: IN-DG01253410

TC-T 6000

Producto controlado

CAS: 949467-71-4

Fórmula: C₂₆H₄₈N₈O₂

Forma y color: Neat

Peso molecular: 504.712

Ref: TR-T127755

TC-T 6000

CAS: 949467-71-4

TC-T 6000 is an advanced chemical compound synthesized from sustainable raw materials, designed to enhance industrial processes. As a high-performance additive, TC-T 6000 acts through its unique molecular structure, facilitating efficient catalysis and improving reaction kinetics in various chemical processes. This product is known for its stability and effectiveness under diverse conditions, making it a versatile tool for researchers and engineers.

Fórmula: C₂₆H₄₈N₈O₂

Pureza: Min. 95%

Peso molecular: 504.7 g/mol

Ref: 3D-ZMB46771

TC-T 6000

CAS: 949467-71-4

TC-T 6000 (hENT4-IN-1) is an ENT4 inhibitor with vasodilator activity that inhibits hENT1 and hENT2 for the study of cancer and cardiovascular damage.

Fórmula: C₂₆H₄₈N₈O₂

Pureza: 98.14%

Forma y color: Yellow Solid

Peso molecular: 504.71

Ref: TM-T34793