CAS 95853-92-2

Fórmula: C20H21ClN2O2

InChI: InChI=1S/C20H21ClN2O2/c1-23-18-10-9-15(21)12-17(18)16(7-3-2-4-8-19(24)25)20(23)14-6-5-11-22-13-14/h5-6,9-13H,2-4,7-8H2,1H3,(H,24,25)

Clave InChI: BYQANTGKEVLUKZ-UHFFFAOYSA-N

SMILES: CN1C2=C(C=C(C=C2)Cl)C(=C1C3=CN=CC=C3)CCCCCC(=O)O

CGS 15435

CAS: 95853-92-2

CGS 15435

Fórmula: C₂₀H₂₁ClN₂O₂

Pureza: 99.5%

Peso molecular: 356.85

Ref: 54-BUP11995

CGS 15435

CAS: 95853-92-2

Fórmula: C₂₀H₂₁ClN₂O₂

Peso molecular: 356.8459

Ref: IN-DA01EOM0

CGS 15435

CAS: 95853-92-2

CGS 15435 is a synthetic compound that functions as a dopamine receptor agonist, derived from chemical synthesis processes involving targeted modifications of organic compounds. It exhibits high affinity and selectivity toward specific subtypes of dopamine receptors, which are G-protein-coupled receptors critical to neurotransmission in the central nervous system.

Fórmula: C₂₀H₂₁ClN₂O₂

Pureza: Min. 95%

Peso molecular: 356.8 g/mol

Ref: 3D-VDA85392

CGS 15435

CAS: 95853-92-2

CGS 15435: potent TxA2 synthase inhibitor, IC50=1 nM; less selective for PGI2 synthase, COX, and liposynthase.

Fórmula: C₂₀H₂₁ClN₂O₂

Pureza: 99.86%

Forma y color: Solid

Peso molecular: 356.846

Ref: TM-T10783