CAS 959417-17-5

Fórmula: C15H12O6

InChI: InChI=1S/C15H12O6/c1-6-3-10(17)13(18)14-11(6)8-4-7(20-2)5-9(16)12(8)15(19)21-14/h3-5,16-18H,1-2H3

Clave InChI: BVYAURIYXKOUPX-UHFFFAOYSA-N

SMILES: CC1=CC(=C(C2=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O)O

4-Hydroxyalternariol 9-methyl ether

CAS: 959417-17-5

4-Hydroxyalternariol 9-methyl ether: antioxidant, antibacterial, MIC 86.7-364.7 uM against various pathogens.

Fórmula: C₁₅H₁₂O₆

Pureza: 98%

Forma y color: Solid

Peso molecular: 288.25

Ref: TM-TN3039

4-Hydroxyalternariol 9-methyl ether

CAS: 959417-17-5

Fórmula: C₁₅H₁₂O₆

Pureza: 95%~99%

Peso molecular: 288.255

Ref: BP-SBP04400

4-Hydroxyalternariol 9-methyl ether

CAS: 959417-17-5

4-Hydroxyalternariol 9-methyl ether is a mycotoxin derivative, which is produced by certain species of the fungus Alternaria. Its biosynthesis occurs naturally in environments where these fungi proliferate, such as on grains and other food products. The compound is an ether derivative of alternariol, characterized by a hydroxyl group addition, providing unique chemical properties.

Fórmula: C₁₅H₁₂O₆

Pureza: Min. 95%

Peso molecular: 288.25 g/mol

Ref: 3D-JNB41717