CAS 96850-21-4

Fórmula: C20H26O4

InChI: InChI=1S/C20H26O4/c1-6-14(4)19(21)23-16-10-12(2)8-7-9-13(3)11-17-18(16)15(5)20(22)24-17/h6,8,11,16-18H,5,7,9-10H2,1-4H3/b12-8+,13-11+,14-6+/t16-,17-,18-/m1/s1

Clave InChI: HXMMJGIMTCOROX-ILWTVLBZSA-N

SMILES: C/C=C(\C)/C(=O)O[C@@H]1C/C(=C/CC/C(=C/[C@@H]2[C@@H]1C(=C)C(=O)O2)/C)/C

8β-Tigloyloxycostunolide

CAS: 96850-21-4

8beta-Tigloyloxycostunolide is a natural product for research related to life sciences. The catalog number is TN3305 and the CAS number is 96850-21-4.

Fórmula: C₂₀H₂₆O₄

Pureza: 98%

Forma y color: Solid

Peso molecular: 330.424

Ref: TM-TN3305

8β-Tigloyloxycostunolide

CAS: 96850-21-4

Fórmula: C₂₀H₂₆O₄

Pureza: 95%~99%

Peso molecular: 330.424

Ref: BP-SBP04110

8Beta-Tigloyloxycostunolide

CAS: 96850-21-4

8Beta-Tigloyloxycostunolide is a sesquiterpene lactone, which is isolated from various medicinal plants such as those belonging to the Asteraceae family. These compounds are renowned for their complex structural frameworks and potent biological activities. The mode of action primarily involves the inhibition of nuclear factor-kappa B (NF-κB) signaling pathways, which plays a crucial role in inflammatory responses. By blocking NF-κB, 8Beta-Tigloyloxycostunolide effectively reduces the expression of pro-inflammatory cytokines and mediators.

Fórmula: C₂₀H₂₆O₄

Pureza: Min. 95%

Peso molecular: 330.4 g/mol

Ref: 3D-WDA85021