CAS 98751-77-0

Fórmula: C17H18O6

InChI: InChI=1S/C17H18O6/c1-17(21)8-13-11(7-14(17)18)12(16(20)23-13)9-22-15(19)10-5-3-2-4-6-10/h2-6,11-13,21H,7-9H2,1H3/t11-,12-,13-,17+/m1/s1

Clave InChI: BDKBBWGLLDEQEV-ZFRZLUBXSA-N

SMILES: C[C@@]1(C[C@@H]2[C@H](CC1=O)[C@H](C(=O)O2)COC(=O)C3=CC=CC=C3)O

2,5(3H,4H)-Benzofurandione,3-[(benzoyloxy)methyl]tetrahydro-6-hydroxy-6-methyl-,(3S,3aR,6S,7aR)-

CAS: 98751-77-0

Fórmula: C₁₇H₁₈O₆

Pureza: 97.0%

Peso molecular: 318.3212

Ref: IN-DA00IK5W

Paeonilactone C

CAS: 98751-77-0

Paeonilactone C significantly protects primary cultures of rat cortical cells against H2O2-induced neurotoxicity.

Fórmula: C₁₇H₁₈O₆

Pureza: 98%

Forma y color: Solid

Peso molecular: 318.32

Ref: TM-TN2037

Paeonilactone C

CAS: 98751-77-0

Fórmula: C₁₇H₁₈O₆

Pureza: 95%~99%

Forma y color: Powder

Peso molecular: 318.325

Ref: BP-SBP02790

Paeonilactone C

CAS: 98751-77-0

Paeonilactone C is a natural compound, which is a secondary metabolite derived from the roots of Paeonia species. This compound is typically isolated through extraction processes that target the phytochemicals present in these plants, renowned for their therapeutic potential in traditional medicine.

Fórmula: C₁₇H₁₈O₆

Pureza: Min. 95%

Peso molecular: 318.32 g/mol

Ref: 3D-YDA75177