CAS 98751-78-1

Fórmula: C10H12O4

InChI: InChI=1S/C10H12O4/c1-5-6-3-8(11)10(2,13)4-7(6)14-9(5)12/h6-7,13H,1,3-4H2,2H3/t6-,7-,10+/m1/s1

Clave InChI: GFSTVWDPRTWASK-XSSZXYGBSA-N

SMILES: C[C@@]1(C[C@@H]2[C@H](CC1=O)C(=C)C(=O)O2)O

Paeonilactone B

CAS: 98751-78-1

Paeonilactone B

Peso molecular: 196.07

Ref: 10-F564462

Paeonilactone B

CAS: 98751-78-1

Paeonilactone B

Fórmula: C₁₀H₁₂O₄

Pureza: 96%

Peso molecular: 196.2

Ref: 54-BUP23125

Paeonilactone B

CAS: 98751-78-1

Paeonilactone B ((+)-Paeonilactone B) from Paeonia lactiflora has neuroprotective activity, inhibits oxidative stress, and inhibits H2O2-induced neurotoxicity.

Fórmula: C₁₀H₁₂O₄

Pureza: 96%

Forma y color: White Solid

Peso molecular: 196.1999

Ref: TM-TN2036

Paeonilactone B

CAS: 98751-78-1

Fórmula: C₁₀H₁₂O₄

Pureza: 95%~99%

Forma y color: Powder

Peso molecular: 196.202

Ref: BP-SBP02789

Paeonilactone B

CAS: 98751-78-1

Fórmula: C₁₀H₁₂O₄

Pureza: 98%

Forma y color: Solid

Peso molecular: 196.1999

Ref: IN-DA00IK5X

Paeonilactone B

CAS: 98751-78-1

Paeonilactone B is a bioactive compound, which is a secondary metabolite derived from the roots of Paeonia species, commonly used in traditional medicine. This compound is extracted and identified through advanced chromatographic and spectrometric techniques, given its natural occurrence in the complex matrix of plant materials.

Fórmula: C₁₀H₁₂O₄

Pureza: Min. 95%

Peso molecular: 196.2 g/mol

Ref: 3D-YDA75178