CAS 98767-37-4

Fórmula: C24H22O15

InChI: InChI=1S/C24H22O15/c25-10-2-1-8(3-11(10)26)23-21(34)19(32)17-12(27)4-9(5-13(17)38-23)37-24-22(35)20(33)18(31)14(39-24)7-36-16(30)6-15(28)29/h1-5,14,18,20,22,24-27,31,33-35H,6-7H2,(H,28,29)/t14-,18-,20+,22-,24-/m1/s1

Clave InChI: GCBLCUVXMBGCQO-ZQIGZIPLSA-N

SMILES: C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)CC(=O)O)O)O)O)O)O)O)O

Quercetin 7-o-(6''-o-malonyl)-beta-D-glucoside

CAS: 98767-37-4

Quercetin 7-o-(6''-o-malonyl)-beta-D-glucoside is a flavonoid glucoside, which is a type of secondary metabolite compound commonly found in various plant species. This compound is derived primarily from plants that contain high levels of quercetin, such as onions, apples, and berries. As a flavonoid, its mode of action involves acting as a potent antioxidant. It achieves this by scavenging free radicals and chelating metal ions, which helps in mitigating oxidative stress and protecting cellular components from damage.

Fórmula: C₂₄H₂₂O₁₅

Pureza: Min. 95%

Peso molecular: 550.4 g/mol

Ref: 3D-YDA76737