CAS 100761-20-4

Formula: C19H22O2

InChI: InChI=1S/C19H22O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-10,18,20H,11-15H2/t18-/m1/s1

InChI key: CCNKTMMNRPJQHV-GOSISDBHSA-N

SMILES: C1=CC=C(C=C1)CC[C@H](CC(=O)CCC2=CC=CC=C2)O

(R)-5-Hydroxy-1,7-diphenyl-3-heptanone

CAS: 100761-20-4

(R)-5-Hydroxy-1,7-diphenyl-3-heptanone

Peso molecolare: 282.16

Ref: 10-F558089

(R)-5-Hydroxy-1,7-diphenylheptan-3-one

CAS: 100761-20-4

(R)-5-Hydroxy-1,7-diphenylheptan-3-one

Formula: C₁₉H₂₂O₂

Purezza: 99.5%

Peso molecolare: 282.38

Ref: 54-BUP00793

(5R)-5-Hydroxy-1,7-diphenyl-3-heptanone

CAS: 100761-20-4

Formula: C₁₉H₂₂O₂

Purezza: 99%

Peso molecolare: 282.3768

Ref: IN-DA0096OS

(R)-5-Hydroxy-1,7-diphenylheptan-3-one

CAS: 100761-20-4

(R)-5-Hydroxy-1,7-diphenylheptan-3-one from Alpinia officinarum inhibits melanogenesis in B16 cells.

Formula: C₁₉H₂₂O₂

Purezza: 99.92%

Colore e forma: Solid

Peso molecolare: 282.3768

Ref: TM-TN6339

(R)-5-Hydroxy-1,7-diphenyl-3-heptanone

CAS: 100761-20-4

(R)-5-Hydroxy-1,7-diphenyl-3-heptanone is a chiral compound, which is synthesized primarily in research laboratories. This compound, due to its specific stereochemistry, is of interest in fields exploring biochemical pathways and potential therapeutic applications.

Formula: C₁₉H₂₂O₂

Purezza: Min. 95%

Peso molecolare: 282.40 g/mol

Ref: 3D-AEA76120